C17H14F3N3O — CID 152915400
8-ethyl-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-amine (PubChem CID 152915400) has the molecular formula C17H14F3N3O and a molecular weight of 333.31 g/mol. Its IUPAC name is 8-ethyl-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-amine.
| Compound Name | 8-ethyl-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 152915400 |
| Molecular Formula | C17H14F3N3O |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 8-ethyl-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-amine |
| SMILES | CCc1cccc2c(N)nc(-c3ccccc3OC(F)(F)F)nc12 |
| InChI | InChI=1S/C17H14F3N3O/c1-2-10-6-5-8-12-14(10)22-16(23-15(12)21)11-7-3-4-9-13(11)24-17(18,19)20/h3-9H,2H2,1H3,(H2,21,22,23) |
| InChIKey | UIALLLYXLMYHFZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |