C26H24F3N5O2 — CID 142127108
N-[1-[[8-methyl-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-yl]amino]ethenyl]-N'-propylfuran-2-carboximidamide (PubChem CID 142127108) has the molecular formula C26H24F3N5O2 and a molecular weight of 495.51 g/mol. Its IUPAC name is N-[1-[[8-methyl-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-yl]amino]ethenyl]-N'-propylfuran-2-carboximidamide.
| Compound Name | N-[1-[[8-methyl-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-yl]amino]ethenyl]-N'-propylfuran-2-carboximidamide |
|---|---|
| PubChem CID | 142127108 |
| Molecular Formula | C26H24F3N5O2 |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-[1-[[8-methyl-2-[2-(trifluoromethoxy)phenyl]quinazolin-4-yl]amino]ethenyl]-N'-propylfuran-2-carboximidamide |
| SMILES | C=C(N/C(=N/CCC)c1ccco1)Nc1nc(-c2ccccc2OC(F)(F)F)nc2c(C)cccc12 |
| InChI | InChI=1S/C26H24F3N5O2/c1-4-14-30-25(21-13-8-15-35-21)32-17(3)31-24-19-11-7-9-16(2)22(19)33-23(34-24)18-10-5-6-12-20(18)36-26(27,28)29/h5-13,15H,3-4,14H2,1-2H3,(H,30,32)(H,31,33,34) |
| InChIKey | NTRACNMFBAXUTN-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|