C30H37N3 — CID 142127156
N-[(E)-4-methylpent-2-en-2-yl]-N'-pentyl-2-(4-phenylanilino)benzenecarboximidamide (PubChem CID 142127156) has the molecular formula C30H37N3 and a molecular weight of 439.65 g/mol. Its IUPAC name is N-[(E)-4-methylpent-2-en-2-yl]-N'-pentyl-2-(4-phenylanilino)benzenecarboximidamide.
| Compound Name | N-[(E)-4-methylpent-2-en-2-yl]-N'-pentyl-2-(4-phenylanilino)benzenecarboximidamide |
|---|---|
| PubChem CID | 142127156 |
| Molecular Formula | C30H37N3 |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.30 |
| IUPAC Name | N-[(E)-4-methylpent-2-en-2-yl]-N'-pentyl-2-(4-phenylanilino)benzenecarboximidamide |
| SMILES | CCCCC/N=C(\N/C(C)=C/C(C)C)c1ccccc1Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H37N3/c1-5-6-12-21-31-30(32-24(4)22-23(2)3)28-15-10-11-16-29(28)33-27-19-17-26(18-20-27)25-13-8-7-9-14-25/h7-11,13-20,22-23,33H,5-6,12,21H2,1-4H3,(H,31,32)/b24-22+ |
| InChIKey | KUKDMCZXOZWGND-ZNTNEXAZSA-N |
| XLogP | 8.18 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|