C28H27ClFN3 — CID 142127288
2-(2-chlorophenyl)-N-[1-(5-fluoro-2-hexan-3-ylphenyl)ethenyl]quinazolin-4-amine (PubChem CID 142127288) has the molecular formula C28H27ClFN3 and a molecular weight of 460.00 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[1-(5-fluoro-2-hexan-3-ylphenyl)ethenyl]quinazolin-4-amine.
| Compound Name | 2-(2-chlorophenyl)-N-[1-(5-fluoro-2-hexan-3-ylphenyl)ethenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 142127288 |
| Molecular Formula | C28H27ClFN3 |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[1-(5-fluoro-2-hexan-3-ylphenyl)ethenyl]quinazolin-4-amine |
| SMILES | C=C(Nc1nc(-c2ccccc2Cl)nc2ccccc12)c1cc(F)ccc1C(CC)CCC |
| InChI | InChI=1S/C28H27ClFN3/c1-4-10-19(5-2)21-16-15-20(30)17-24(21)18(3)31-28-23-12-7-9-14-26(23)32-27(33-28)22-11-6-8-13-25(22)29/h6-9,11-17,19H,3-5,10H2,1-2H3,(H,31,32,33) |
| InChIKey | LRKOGYJVQDKTDH-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |