C21H21F2N5 — CID 142126651
N-[1-[[2-(2,4-difluorophenyl)quinazolin-4-yl]amino]ethenyl]-N'-propylethanimidamide (PubChem CID 142126651) has the molecular formula C21H21F2N5 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-[1-[[2-(2,4-difluorophenyl)quinazolin-4-yl]amino]ethenyl]-N'-propylethanimidamide.
| Compound Name | N-[1-[[2-(2,4-difluorophenyl)quinazolin-4-yl]amino]ethenyl]-N'-propylethanimidamide |
|---|---|
| PubChem CID | 142126651 |
| Molecular Formula | C21H21F2N5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-[1-[[2-(2,4-difluorophenyl)quinazolin-4-yl]amino]ethenyl]-N'-propylethanimidamide |
| SMILES | C=C(N/C(C)=N/CCC)Nc1nc(-c2ccc(F)cc2F)nc2ccccc12 |
| InChI | InChI=1S/C21H21F2N5/c1-4-11-24-13(2)25-14(3)26-21-17-7-5-6-8-19(17)27-20(28-21)16-10-9-15(22)12-18(16)23/h5-10,12H,3-4,11H2,1-2H3,(H,24,25)(H,26,27,28) |
| InChIKey | FKVNXIGWHOBSAP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|