C25H24F3N3O2 — CID 142127687
(3Z,5E)-5-methyl-7-[[8-methyl-2-[2-(trifluoromethoxy)phenyl]-1,2-dihydroquinazolin-4-yl]amino]octa-1,3,5,7-tetraen-4-ol (PubChem CID 142127687) has the molecular formula C25H24F3N3O2 and a molecular weight of 455.48 g/mol. Its IUPAC name is (3Z,5E)-5-methyl-7-[[8-methyl-2-[2-(trifluoromethoxy)phenyl]-1,2-dihydroquinazolin-4-yl]amino]octa-1,3,5,7-tetraen-4-ol.
| Compound Name | (3Z,5E)-5-methyl-7-[[8-methyl-2-[2-(trifluoromethoxy)phenyl]-1,2-dihydroquinazolin-4-yl]amino]octa-1,3,5,7-tetraen-4-ol |
|---|---|
| PubChem CID | 142127687 |
| Molecular Formula | C25H24F3N3O2 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | (3Z,5E)-5-methyl-7-[[8-methyl-2-[2-(trifluoromethoxy)phenyl]-1,2-dihydroquinazolin-4-yl]amino]octa-1,3,5,7-tetraen-4-ol |
| SMILES | C=C/C=C(O)/C(C)=C/C(=C)NC1=NC(c2ccccc2OC(F)(F)F)Nc2c(C)cccc21 |
| InChI | InChI=1S/C25H24F3N3O2/c1-5-9-20(32)16(3)14-17(4)29-24-19-12-8-10-15(2)22(19)30-23(31-24)18-11-6-7-13-21(18)33-25(26,27)28/h5-14,23,30,32H,1,4H2,2-3H3,(H,29,31)/b16-14+,20-9- |
| InChIKey | GVBQPMPHMOLSOX-LCFRXKBPSA-N |
| XLogP | 6.44 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|