C22H34F3N5 — CID 142127797
ethane;N-methyl-2-[2-(trifluoromethyl)phenyl]-2,3,5,6,7,8-hexahydro-1H-quinazolin-4-imine;N'-propylmethanimidamide (PubChem CID 142127797) has the molecular formula C22H34F3N5 and a molecular weight of 425.54 g/mol. Its IUPAC name is ethane;N-methyl-2-[2-(trifluoromethyl)phenyl]-2,3,5,6,7,8-hexahydro-1H-quinazolin-4-imine;N'-propylmethanimidamide.
| Compound Name | ethane;N-methyl-2-[2-(trifluoromethyl)phenyl]-2,3,5,6,7,8-hexahydro-1H-quinazolin-4-imine;N'-propylmethanimidamide |
|---|---|
| PubChem CID | 142127797 |
| Molecular Formula | C22H34F3N5 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | ethane;N-methyl-2-[2-(trifluoromethyl)phenyl]-2,3,5,6,7,8-hexahydro-1H-quinazolin-4-imine;N'-propylmethanimidamide |
| SMILES | C/N=C1\NC(c2ccccc2C(F)(F)F)NC2=C1CCCC2.CC.CCC/N=C/N |
| InChI | InChI=1S/C16H18F3N3.C4H10N2.C2H6/c1-20-14-11-7-3-5-9-13(11)21-15(22-14)10-6-2-4-8-12(10)16(17,18)19;1-2-3-6-4-5;1-2/h2,4,6,8,15,21H,3,5,7,9H2,1H3,(H,20,22);4H,2-3H2,1H3,(H2,5,6);1-2H3 |
| InChIKey | VGQJRYWGOZMONF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|