C29H34F5N3 — CID 142127632
N-[1-(3,5-difluoro-2-methylphenyl)ethenyl]-2-[2-(trifluoromethyl)phenyl]-1,2,5,6,7,8-hexahydroquinazolin-4-amine;pentane (PubChem CID 142127632) has the molecular formula C29H34F5N3 and a molecular weight of 519.60 g/mol. Its IUPAC name is N-[1-(3,5-difluoro-2-methylphenyl)ethenyl]-2-[2-(trifluoromethyl)phenyl]-1,2,5,6,7,8-hexahydroquinazolin-4-amine;pentane.
| Compound Name | N-[1-(3,5-difluoro-2-methylphenyl)ethenyl]-2-[2-(trifluoromethyl)phenyl]-1,2,5,6,7,8-hexahydroquinazolin-4-amine;pentane |
|---|---|
| PubChem CID | 142127632 |
| Molecular Formula | C29H34F5N3 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | N-[1-(3,5-difluoro-2-methylphenyl)ethenyl]-2-[2-(trifluoromethyl)phenyl]-1,2,5,6,7,8-hexahydroquinazolin-4-amine;pentane |
| SMILES | C=C(NC1=NC(c2ccccc2C(F)(F)F)NC2=C1CCCC2)c1cc(F)cc(F)c1C.CCCCC |
| InChI | InChI=1S/C24H22F5N3.C5H12/c1-13-18(11-15(25)12-20(13)26)14(2)30-23-17-8-4-6-10-21(17)31-22(32-23)16-7-3-5-9-19(16)24(27,28)29;1-3-5-4-2/h3,5,7,9,11-12,22,31H,2,4,6,8,10H2,1H3,(H,30,32);3-5H2,1-2H3 |
| InChIKey | QLTUVXZNRHPPMA-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |