C23H19F5N4 — CID 142127373
2-amino-N-[1-(3,5-difluoro-2-methylphenyl)ethenyl]-N'-[[2-(trifluoromethyl)phenyl]methyl]pyridine-3-carboximidamide (PubChem CID 142127373) has the molecular formula C23H19F5N4 and a molecular weight of 446.42 g/mol. Its IUPAC name is 2-amino-N-[1-(3,5-difluoro-2-methylphenyl)ethenyl]-N'-[[2-(trifluoromethyl)phenyl]methyl]pyridine-3-carboximidamide.
| Compound Name | 2-amino-N-[1-(3,5-difluoro-2-methylphenyl)ethenyl]-N'-[[2-(trifluoromethyl)phenyl]methyl]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 142127373 |
| Molecular Formula | C23H19F5N4 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 2-amino-N-[1-(3,5-difluoro-2-methylphenyl)ethenyl]-N'-[[2-(trifluoromethyl)phenyl]methyl]pyridine-3-carboximidamide |
| SMILES | C=C(N/C(=N/Cc1ccccc1C(F)(F)F)c1cccnc1N)c1cc(F)cc(F)c1C |
| InChI | InChI=1S/C23H19F5N4/c1-13-18(10-16(24)11-20(13)25)14(2)32-22(17-7-5-9-30-21(17)29)31-12-15-6-3-4-8-19(15)23(26,27)28/h3-11H,2,12H2,1H3,(H2,29,30)(H,31,32) |
| InChIKey | JCOZBSXNQGPTMT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|