C28H34F4N4 — CID 142126193
N-[1-(5-fluoro-2-methylphenyl)ethenyl]-2-[2-(trifluoromethyl)phenyl]-1,2,5,6,7,8-hexahydropyrido[3,4-d]pyrimidin-4-amine;pentane (PubChem CID 142126193) has the molecular formula C28H34F4N4 and a molecular weight of 502.60 g/mol. Its IUPAC name is N-[1-(5-fluoro-2-methylphenyl)ethenyl]-2-[2-(trifluoromethyl)phenyl]-1,2,5,6,7,8-hexahydropyrido[3,4-d]pyrimidin-4-amine;pentane.
| Compound Name | N-[1-(5-fluoro-2-methylphenyl)ethenyl]-2-[2-(trifluoromethyl)phenyl]-1,2,5,6,7,8-hexahydropyrido[3,4-d]pyrimidin-4-amine;pentane |
|---|---|
| PubChem CID | 142126193 |
| Molecular Formula | C28H34F4N4 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | N-[1-(5-fluoro-2-methylphenyl)ethenyl]-2-[2-(trifluoromethyl)phenyl]-1,2,5,6,7,8-hexahydropyrido[3,4-d]pyrimidin-4-amine;pentane |
| SMILES | C=C(NC1=NC(c2ccccc2C(F)(F)F)NC2=C1CCNC2)c1cc(F)ccc1C.CCCCC |
| InChI | InChI=1S/C23H22F4N4.C5H12/c1-13-7-8-15(24)11-18(13)14(2)29-22-17-9-10-28-12-20(17)30-21(31-22)16-5-3-4-6-19(16)23(25,26)27;1-3-5-4-2/h3-8,11,21,28,30H,2,9-10,12H2,1H3,(H,29,31);3-5H2,1-2H3 |
| InChIKey | FNHGBQWRQJJAPQ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |