C33H42F4N2 — CID 142127883
6-cyclohexyl-N-[1-(4-fluoro-2-methylphenyl)ethenyl]-2-[2-(trifluoromethyl)phenyl]-1,2-dihydropyridin-4-amine;hexane (PubChem CID 142127883) has the molecular formula C33H42F4N2 and a molecular weight of 542.71 g/mol. Its IUPAC name is 6-cyclohexyl-N-[1-(4-fluoro-2-methylphenyl)ethenyl]-2-[2-(trifluoromethyl)phenyl]-1,2-dihydropyridin-4-amine;hexane.
| Compound Name | 6-cyclohexyl-N-[1-(4-fluoro-2-methylphenyl)ethenyl]-2-[2-(trifluoromethyl)phenyl]-1,2-dihydropyridin-4-amine;hexane |
|---|---|
| PubChem CID | 142127883 |
| Molecular Formula | C33H42F4N2 |
| Molecular Weight | 542.71 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | 6-cyclohexyl-N-[1-(4-fluoro-2-methylphenyl)ethenyl]-2-[2-(trifluoromethyl)phenyl]-1,2-dihydropyridin-4-amine;hexane |
| SMILES | C=C(NC1=CC(c2ccccc2C(F)(F)F)NC(C2CCCCC2)=C1)c1ccc(F)cc1C.CCCCCC |
| InChI | InChI=1S/C27H28F4N2.C6H14/c1-17-14-20(28)12-13-22(17)18(2)32-21-15-25(19-8-4-3-5-9-19)33-26(16-21)23-10-6-7-11-24(23)27(29,30)31;1-3-5-6-4-2/h6-7,10-16,19,26,32-33H,2-5,8-9H2,1H3;3-6H2,1-2H3 |
| InChIKey | KYZBGKFTQCFRHZ-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.71 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|