C19H25FN4 — CID 142128210
N'-[1-[3-fluoro-2-(propylamino)phenyl]ethyl]-2-(methylamino)benzenecarboximidamide (PubChem CID 142128210) has the molecular formula C19H25FN4 and a molecular weight of 328.44 g/mol. Its IUPAC name is N'-[1-[3-fluoro-2-(propylamino)phenyl]ethyl]-2-(methylamino)benzenecarboximidamide.
| Compound Name | N'-[1-[3-fluoro-2-(propylamino)phenyl]ethyl]-2-(methylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 142128210 |
| Molecular Formula | C19H25FN4 |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | N'-[1-[3-fluoro-2-(propylamino)phenyl]ethyl]-2-(methylamino)benzenecarboximidamide |
| SMILES | CCCNc1c(F)cccc1C(C)/N=C(\N)c1ccccc1NC |
| InChI | InChI=1S/C19H25FN4/c1-4-12-23-18-14(9-7-10-16(18)20)13(2)24-19(21)15-8-5-6-11-17(15)22-3/h5-11,13,22-23H,4,12H2,1-3H3,(H2,21,24) |
| InChIKey | MKHPARRHAPLFAE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|