C19H28 — CID 142132562
1,5-dimethyl-2-(4-methylheptan-3-yl)-1H-indene (PubChem CID 142132562) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is 1,5-dimethyl-2-(4-methylheptan-3-yl)-1H-indene.
| Compound Name | 1,5-dimethyl-2-(4-methylheptan-3-yl)-1H-indene |
|---|---|
| PubChem CID | 142132562 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1,5-dimethyl-2-(4-methylheptan-3-yl)-1H-indene |
| SMILES | CCCC(C)C(CC)C1=Cc2cc(C)ccc2C1C |
| InChI | InChI=1S/C19H28/c1-6-8-14(4)17(7-2)19-12-16-11-13(3)9-10-18(16)15(19)5/h9-12,14-15,17H,6-8H2,1-5H3 |
| InChIKey | WQPOHRKPALFVPX-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |