C22H30Cl2N2O5 — CID 142133043
2-[4-[[[2-[[(2Z,4E)-4,6-dichlorohexa-2,4-dienyl]amino]-2-oxoethyl]-(2-methoxyethyl)amino]methyl]phenoxy]-2-methylpropanoic acid (PubChem CID 142133043) has the molecular formula C22H30Cl2N2O5 and a molecular weight of 473.40 g/mol. Its IUPAC name is 2-[4-[[[2-[[(2Z,4E)-4,6-dichlorohexa-2,4-dienyl]amino]-2-oxoethyl]-(2-methoxyethyl)amino]methyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[[[2-[[(2Z,4E)-4,6-dichlorohexa-2,4-dienyl]amino]-2-oxoethyl]-(2-methoxyethyl)amino]methyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 142133043 |
| Molecular Formula | C22H30Cl2N2O5 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 2-[4-[[[2-[[(2Z,4E)-4,6-dichlorohexa-2,4-dienyl]amino]-2-oxoethyl]-(2-methoxyethyl)amino]methyl]phenoxy]-2-methylpropanoic acid |
| SMILES | COCCN(CC(=O)NC/C=C\C(Cl)=C/CCl)Cc1ccc(OC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C22H30Cl2N2O5/c1-22(2,21(28)29)31-19-8-6-17(7-9-19)15-26(13-14-30-3)16-20(27)25-12-4-5-18(24)10-11-23/h4-10H,11-16H2,1-3H3,(H,25,27)(H,28,29)/b5-4-,18-10+ |
| InChIKey | YYKFQSTZMYQYMF-SSAWSCCNSA-N |
| XLogP | 3.41 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|