C28H52O4S2 — CID 142135553
6-[5-[(Z)-2-[5-(6-hydroxy-5,5-dimethylhexyl)-1-oxothiolan-2-yl]ethenyl]-1-oxothiolan-2-yl]-2-methyl-2-propylhexan-1-ol (PubChem CID 142135553) has the molecular formula C28H52O4S2 and a molecular weight of 516.85 g/mol. Its IUPAC name is 6-[5-[(Z)-2-[5-(6-hydroxy-5,5-dimethylhexyl)-1-oxothiolan-2-yl]ethenyl]-1-oxothiolan-2-yl]-2-methyl-2-propylhexan-1-ol.
| Compound Name | 6-[5-[(Z)-2-[5-(6-hydroxy-5,5-dimethylhexyl)-1-oxothiolan-2-yl]ethenyl]-1-oxothiolan-2-yl]-2-methyl-2-propylhexan-1-ol |
|---|---|
| PubChem CID | 142135553 |
| Molecular Formula | C28H52O4S2 |
| Molecular Weight | 516.85 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | 6-[5-[(Z)-2-[5-(6-hydroxy-5,5-dimethylhexyl)-1-oxothiolan-2-yl]ethenyl]-1-oxothiolan-2-yl]-2-methyl-2-propylhexan-1-ol |
| SMILES | CCCC(C)(CO)CCCCC1CCC(/C=C\C2CCC(CCCCC(C)(C)CO)S2=O)S1=O |
| InChI | InChI=1S/C28H52O4S2/c1-5-18-28(4,22-30)20-9-7-11-24-13-15-26(34(24)32)17-16-25-14-12-23(33(25)31)10-6-8-19-27(2,3)21-29/h16-17,23-26,29-30H,5-15,18-22H2,1-4H3/b17-16- |
| InChIKey | LGHRSYFGFOUIEC-MSUUIHNZSA-N |
| XLogP | 6.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.85 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|