C30H54O3S2 — CID 143048204
6-[6-[(Z)-2-[6-[5-(hydroxymethyl)-5-methyloctyl]thian-2-yl]ethenyl]thian-2-yl]-2,2-dimethylhexanoic acid (PubChem CID 143048204) has the molecular formula C30H54O3S2 and a molecular weight of 526.89 g/mol. Its IUPAC name is 6-[6-[(Z)-2-[6-[5-(hydroxymethyl)-5-methyloctyl]thian-2-yl]ethenyl]thian-2-yl]-2,2-dimethylhexanoic acid.
| Compound Name | 6-[6-[(Z)-2-[6-[5-(hydroxymethyl)-5-methyloctyl]thian-2-yl]ethenyl]thian-2-yl]-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 143048204 |
| Molecular Formula | C30H54O3S2 |
| Molecular Weight | 526.89 g/mol |
| Exact Mass | 526.35 |
| IUPAC Name | 6-[6-[(Z)-2-[6-[5-(hydroxymethyl)-5-methyloctyl]thian-2-yl]ethenyl]thian-2-yl]-2,2-dimethylhexanoic acid |
| SMILES | CCCC(C)(CO)CCCCC1CCCC(/C=C\C2CCCC(CCCCC(C)(C)C(=O)O)S2)S1 |
| InChI | InChI=1S/C30H54O3S2/c1-5-20-30(4,23-31)22-9-7-13-25-15-11-17-27(35-25)19-18-26-16-10-14-24(34-26)12-6-8-21-29(2,3)28(32)33/h18-19,24-27,31H,5-17,20-23H2,1-4H3,(H,32,33)/b19-18- |
| InChIKey | RLFGZWOHQUDJNM-HNENSFHCSA-N |
| XLogP | 8.88 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.89 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|