C20H38OS2 — CID 141186598
2,2-dimethyl-6-[6-[2-(thian-2-yl)ethyl]thian-2-yl]hexan-1-ol (PubChem CID 141186598) has the molecular formula C20H38OS2 and a molecular weight of 358.66 g/mol. Its IUPAC name is 2,2-dimethyl-6-[6-[2-(thian-2-yl)ethyl]thian-2-yl]hexan-1-ol.
| Compound Name | 2,2-dimethyl-6-[6-[2-(thian-2-yl)ethyl]thian-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 141186598 |
| Molecular Formula | C20H38OS2 |
| Molecular Weight | 358.66 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 2,2-dimethyl-6-[6-[2-(thian-2-yl)ethyl]thian-2-yl]hexan-1-ol |
| SMILES | CC(C)(CO)CCCCC1CCCC(CCC2CCCCS2)S1 |
| InChI | InChI=1S/C20H38OS2/c1-20(2,16-21)14-5-3-9-18-10-7-11-19(23-18)13-12-17-8-4-6-15-22-17/h17-19,21H,3-16H2,1-2H3 |
| InChIKey | OLGPSWGANKVLBL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|