C30H56O3 — CID 67518628
2-(5,5-dimethylhexyl)-6-[(Z)-2-[2-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)cyclohexyl]ethenyl]cyclohexan-1-ol (PubChem CID 67518628) has the molecular formula C30H56O3 and a molecular weight of 464.78 g/mol. Its IUPAC name is 2-(5,5-dimethylhexyl)-6-[(Z)-2-[2-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)cyclohexyl]ethenyl]cyclohexan-1-ol.
| Compound Name | 2-(5,5-dimethylhexyl)-6-[(Z)-2-[2-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)cyclohexyl]ethenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 67518628 |
| Molecular Formula | C30H56O3 |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 464.42 |
| IUPAC Name | 2-(5,5-dimethylhexyl)-6-[(Z)-2-[2-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)cyclohexyl]ethenyl]cyclohexan-1-ol |
| SMILES | CC(C)(C)CCCCC1CCCC(/C=C\C2CCCC(CCCCC(C)(C)CO)C2O)C1O |
| InChI | InChI=1S/C30H56O3/c1-29(2,3)20-8-6-12-23-14-10-16-25(27(23)32)18-19-26-17-11-15-24(28(26)33)13-7-9-21-30(4,5)22-31/h18-19,23-28,31-33H,6-17,20-22H2,1-5H3/b19-18- |
| InChIKey | UZFQKFGXAMGDBL-HNENSFHCSA-N |
| XLogP | 7.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|