C27H42O6 — CID 142135869
2-(4-butoxy-2,2-dimethylbutyl)pyran-4-one;2-(2,2-dimethylpentyl)-5-hydroxypyran-4-one (PubChem CID 142135869) has the molecular formula C27H42O6 and a molecular weight of 462.63 g/mol. Its IUPAC name is 2-(4-butoxy-2,2-dimethylbutyl)pyran-4-one;2-(2,2-dimethylpentyl)-5-hydroxypyran-4-one.
| Compound Name | 2-(4-butoxy-2,2-dimethylbutyl)pyran-4-one;2-(2,2-dimethylpentyl)-5-hydroxypyran-4-one |
|---|---|
| PubChem CID | 142135869 |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 2-(4-butoxy-2,2-dimethylbutyl)pyran-4-one;2-(2,2-dimethylpentyl)-5-hydroxypyran-4-one |
| SMILES | CCCC(C)(C)Cc1cc(=O)c(O)co1.CCCCOCCC(C)(C)Cc1cc(=O)cco1 |
| InChI | InChI=1S/C15H24O3.C12H18O3/c1-4-5-8-17-10-7-15(2,3)12-14-11-13(16)6-9-18-14;1-4-5-12(2,3)7-9-6-10(13)11(14)8-15-9/h6,9,11H,4-5,7-8,10,12H2,1-3H3;6,8,14H,4-5,7H2,1-3H3 |
| InChIKey | XBWTZKUJIOGHOL-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|