C12H14O3 — CID 24974422
2-hydroxy-5-methoxyspiro[5.5]undeca-1,4,9-trien-3-one (PubChem CID 24974422) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-hydroxy-5-methoxyspiro[5.5]undeca-1,4,9-trien-3-one.
| Compound Name | 2-hydroxy-5-methoxyspiro[5.5]undeca-1,4,9-trien-3-one |
|---|---|
| PubChem CID | 24974422 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-hydroxy-5-methoxyspiro[5.5]undeca-1,4,9-trien-3-one |
| SMILES | COC1=CC(=O)C(O)=CC12CC=CCC2 |
| InChI | InChI=1S/C12H14O3/c1-15-11-7-9(13)10(14)8-12(11)5-3-2-4-6-12/h2-3,7-8,14H,4-6H2,1H3 |
| InChIKey | KMYWSEFIPXDPNM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|