C9H17N — CID 142136082
ethane;2,4,5-trimethyl-3H-pyrrole (PubChem CID 142136082) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is ethane;2,4,5-trimethyl-3H-pyrrole.
| Compound Name | ethane;2,4,5-trimethyl-3H-pyrrole |
|---|---|
| PubChem CID | 142136082 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | ethane;2,4,5-trimethyl-3H-pyrrole |
| SMILES | CC.CC1=NC(C)=C(C)C1 |
| InChI | InChI=1S/C7H11N.C2H6/c1-5-4-6(2)8-7(5)3;1-2/h4H2,1-3H3;1-2H3 |
| InChIKey | APPUFOVDJNBRPI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |