C8H13NO — CID 142136887
2-(4-aminocyclohexa-1,5-dien-1-yl)ethanol (PubChem CID 142136887) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-(4-aminocyclohexa-1,5-dien-1-yl)ethanol.
| Compound Name | 2-(4-aminocyclohexa-1,5-dien-1-yl)ethanol |
|---|---|
| PubChem CID | 142136887 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 2-(4-aminocyclohexa-1,5-dien-1-yl)ethanol |
| SMILES | NC1C=CC(CCO)=CC1 |
| InChI | InChI=1S/C8H13NO/c9-8-3-1-7(2-4-8)5-6-10/h1-3,8,10H,4-6,9H2 |
| InChIKey | ILAHRXRKSJWXPV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |