C17H28N2O2S — CID 142137372
ethane;1-(4-methylcyclohexen-1-yl)-4-[2-(sulfamoylamino)ethyl]benzene (PubChem CID 142137372) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is ethane;1-(4-methylcyclohexen-1-yl)-4-[2-(sulfamoylamino)ethyl]benzene.
| Compound Name | ethane;1-(4-methylcyclohexen-1-yl)-4-[2-(sulfamoylamino)ethyl]benzene |
|---|---|
| PubChem CID | 142137372 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | ethane;1-(4-methylcyclohexen-1-yl)-4-[2-(sulfamoylamino)ethyl]benzene |
| SMILES | CC.CC1CC=C(c2ccc(CCNS(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C15H22N2O2S.C2H6/c1-12-2-6-14(7-3-12)15-8-4-13(5-9-15)10-11-17-20(16,18)19;1-2/h4-6,8-9,12,17H,2-3,7,10-11H2,1H3,(H2,16,18,19);1-2H3 |
| InChIKey | BIGGAGOCIUXLFS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |