C8H14N2O — CID 142138593
1-ethyl-3-methoxy-4,5-dimethylpyrazole (PubChem CID 142138593) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-ethyl-3-methoxy-4,5-dimethylpyrazole.
| Compound Name | 1-ethyl-3-methoxy-4,5-dimethylpyrazole |
|---|---|
| PubChem CID | 142138593 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 1-ethyl-3-methoxy-4,5-dimethylpyrazole |
| SMILES | CCn1nc(OC)c(C)c1C |
| InChI | InChI=1S/C8H14N2O/c1-5-10-7(3)6(2)8(9-10)11-4/h5H2,1-4H3 |
| InChIKey | CYNHGKPHKUOTFH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |