C8H12N2O2 — CID 174359314
(1-ethyl-3,5-dimethylpyrazol-4-yl) formate (PubChem CID 174359314) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is (1-ethyl-3,5-dimethylpyrazol-4-yl) formate.
| Compound Name | (1-ethyl-3,5-dimethylpyrazol-4-yl) formate |
|---|---|
| PubChem CID | 174359314 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | (1-ethyl-3,5-dimethylpyrazol-4-yl) formate |
| SMILES | CCn1nc(C)c(OC=O)c1C |
| InChI | InChI=1S/C8H12N2O2/c1-4-10-7(3)8(12-5-11)6(2)9-10/h5H,4H2,1-3H3 |
| InChIKey | JMTLVXJSEHKXCK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|