C15H18N2O3 — CID 56696636
[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)oxyphenyl] acetate (PubChem CID 56696636) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is [2-(1-ethyl-3,5-dimethylpyrazol-4-yl)oxyphenyl] acetate.
| Compound Name | [2-(1-ethyl-3,5-dimethylpyrazol-4-yl)oxyphenyl] acetate |
|---|---|
| PubChem CID | 56696636 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | [2-(1-ethyl-3,5-dimethylpyrazol-4-yl)oxyphenyl] acetate |
| SMILES | CCn1nc(C)c(Oc2ccccc2OC(C)=O)c1C |
| InChI | InChI=1S/C15H18N2O3/c1-5-17-11(3)15(10(2)16-17)20-14-9-7-6-8-13(14)19-12(4)18/h6-9H,5H2,1-4H3 |
| InChIKey | GJDYRCKWMZHSAG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|