C8H13NO2 — CID 142140047
ethene;1,2,3,6-tetrahydropyridine-4-carboxylic acid (PubChem CID 142140047) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is ethene;1,2,3,6-tetrahydropyridine-4-carboxylic acid.
| Compound Name | ethene;1,2,3,6-tetrahydropyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 142140047 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | ethene;1,2,3,6-tetrahydropyridine-4-carboxylic acid |
| SMILES | C=C.O=C(O)C1=CCNCC1 |
| InChI | InChI=1S/C6H9NO2.C2H4/c8-6(9)5-1-3-7-4-2-5;1-2/h1,7H,2-4H2,(H,8,9);1-2H2 |
| InChIKey | PNFPOKMLXITKBK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|