C20H31ClO3 — CID 142141391
1-buta-1,3-dien-2-yl-4-(3-chloropropoxy)cyclohexa-1,3-diene;ethane;methyl 2-methylprop-2-enoate (PubChem CID 142141391) has the molecular formula C20H31ClO3 and a molecular weight of 354.92 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-4-(3-chloropropoxy)cyclohexa-1,3-diene;ethane;methyl 2-methylprop-2-enoate.
| Compound Name | 1-buta-1,3-dien-2-yl-4-(3-chloropropoxy)cyclohexa-1,3-diene;ethane;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142141391 |
| Molecular Formula | C20H31ClO3 |
| Molecular Weight | 354.92 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-4-(3-chloropropoxy)cyclohexa-1,3-diene;ethane;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=CC(=C)C1=CC=C(OCCCCl)CC1.CC |
| InChI | InChI=1S/C13H17ClO.C5H8O2.C2H6/c1-3-11(2)12-5-7-13(8-6-12)15-10-4-9-14;1-4(2)5(6)7-3;1-2/h3,5,7H,1-2,4,6,8-10H2;1H2,2-3H3;1-2H3 |
| InChIKey | BYMIRBZZVOAYOE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.92 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|