C15H23ClO3 — CID 15480392
ethyl (2Z)-2-[2-(chloromethyl)-6-pentyl-2,3-dihydropyran-4-ylidene]acetate (PubChem CID 15480392) has the molecular formula C15H23ClO3 and a molecular weight of 286.80 g/mol. Its IUPAC name is ethyl (2Z)-2-[2-(chloromethyl)-6-pentyl-2,3-dihydropyran-4-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[2-(chloromethyl)-6-pentyl-2,3-dihydropyran-4-ylidene]acetate |
|---|---|
| PubChem CID | 15480392 |
| Molecular Formula | C15H23ClO3 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | ethyl (2Z)-2-[2-(chloromethyl)-6-pentyl-2,3-dihydropyran-4-ylidene]acetate |
| SMILES | CCCCCC1=C/C(=C\C(=O)OCC)CC(CCl)O1 |
| InChI | InChI=1S/C15H23ClO3/c1-3-5-6-7-13-8-12(9-14(11-16)19-13)10-15(17)18-4-2/h8,10,14H,3-7,9,11H2,1-2H3/b12-10+ |
| InChIKey | IKUPICMOOHUBQC-ZRDIBKRKSA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|