C14H19ClO2 — CID 123541259
propan-2-yl 4-chloro-6-ethenyl-5-ethylcyclohexa-1,5-diene-1-carboxylate (PubChem CID 123541259) has the molecular formula C14H19ClO2 and a molecular weight of 254.76 g/mol. Its IUPAC name is propan-2-yl 4-chloro-6-ethenyl-5-ethylcyclohexa-1,5-diene-1-carboxylate.
| Compound Name | propan-2-yl 4-chloro-6-ethenyl-5-ethylcyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 123541259 |
| Molecular Formula | C14H19ClO2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | propan-2-yl 4-chloro-6-ethenyl-5-ethylcyclohexa-1,5-diene-1-carboxylate |
| SMILES | C=CC1=C(CC)C(Cl)CC=C1C(=O)OC(C)C |
| InChI | InChI=1S/C14H19ClO2/c1-5-10-11(6-2)13(15)8-7-12(10)14(16)17-9(3)4/h5,7,9,13H,1,6,8H2,2-4H3 |
| InChIKey | RVHDRIGAGOYOOY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|