C14H19ClO2 — CID 142587147
propan-2-yl (2Z,3E)-3-chloro-4-ethenyl-2-ethylidene-5-methylhexa-3,5-dienoate (PubChem CID 142587147) has the molecular formula C14H19ClO2 and a molecular weight of 254.76 g/mol. Its IUPAC name is propan-2-yl (2Z,3E)-3-chloro-4-ethenyl-2-ethylidene-5-methylhexa-3,5-dienoate.
| Compound Name | propan-2-yl (2Z,3E)-3-chloro-4-ethenyl-2-ethylidene-5-methylhexa-3,5-dienoate |
|---|---|
| PubChem CID | 142587147 |
| Molecular Formula | C14H19ClO2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | propan-2-yl (2Z,3E)-3-chloro-4-ethenyl-2-ethylidene-5-methylhexa-3,5-dienoate |
| SMILES | C=C/C(C(=C)C)=C(Cl)/C(=C\C)C(=O)OC(C)C |
| InChI | InChI=1S/C14H19ClO2/c1-7-11(9(3)4)13(15)12(8-2)14(16)17-10(5)6/h7-8,10H,1,3H2,2,4-6H3/b12-8+,13-11+ |
| InChIKey | FOXCFHFLGOELKW-UHSWXSRBSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|