C14H21ClO2 — CID 57063115
(E)-5-chloro-4-(2,6-dimethyl-3,6-dihydro-2H-pyran-5-yl)-3-ethylpent-3-en-2-one (PubChem CID 57063115) has the molecular formula C14H21ClO2 and a molecular weight of 256.77 g/mol. Its IUPAC name is (E)-5-chloro-4-(2,6-dimethyl-3,6-dihydro-2H-pyran-5-yl)-3-ethylpent-3-en-2-one.
| Compound Name | (E)-5-chloro-4-(2,6-dimethyl-3,6-dihydro-2H-pyran-5-yl)-3-ethylpent-3-en-2-one |
|---|---|
| PubChem CID | 57063115 |
| Molecular Formula | C14H21ClO2 |
| Molecular Weight | 256.77 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (E)-5-chloro-4-(2,6-dimethyl-3,6-dihydro-2H-pyran-5-yl)-3-ethylpent-3-en-2-one |
| SMILES | CC/C(C(C)=O)=C(\CCl)C1=CCC(C)OC1C |
| InChI | InChI=1S/C14H21ClO2/c1-5-12(10(3)16)14(8-15)13-7-6-9(2)17-11(13)4/h7,9,11H,5-6,8H2,1-4H3/b14-12- |
| InChIKey | HHAVLZCDOGDVCO-OWBHPGMISA-N |
| XLogP | 3.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|