C19H25ClO3 — CID 76528742
2-(11-chloro-7,10-dimethylundeca-3,5,8,10-tetraenyl)-4-methoxy-2,3-dihydropyran-6-one (PubChem CID 76528742) has the molecular formula C19H25ClO3 and a molecular weight of 336.86 g/mol. Its IUPAC name is 2-(11-chloro-7,10-dimethylundeca-3,5,8,10-tetraenyl)-4-methoxy-2,3-dihydropyran-6-one.
| Compound Name | 2-(11-chloro-7,10-dimethylundeca-3,5,8,10-tetraenyl)-4-methoxy-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 76528742 |
| Molecular Formula | C19H25ClO3 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-(11-chloro-7,10-dimethylundeca-3,5,8,10-tetraenyl)-4-methoxy-2,3-dihydropyran-6-one |
| SMILES | COC1=CC(=O)OC(CCC=CC=CC(C)C=CC(C)=CCl)C1 |
| InChI | InChI=1S/C19H25ClO3/c1-15(10-11-16(2)14-20)8-6-4-5-7-9-17-12-18(22-3)13-19(21)23-17/h4-6,8,10-11,13-15,17H,7,9,12H2,1-3H3 |
| InChIKey | FFQPDMLQLMDNCB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|