C13H18O3 — CID 178114093
4-methoxy-2-[(3E)-3-methylhexa-3,5-dienyl]-2,3-dihydropyran-6-one (PubChem CID 178114093) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 4-methoxy-2-[(3E)-3-methylhexa-3,5-dienyl]-2,3-dihydropyran-6-one.
| Compound Name | 4-methoxy-2-[(3E)-3-methylhexa-3,5-dienyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 178114093 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 4-methoxy-2-[(3E)-3-methylhexa-3,5-dienyl]-2,3-dihydropyran-6-one |
| SMILES | C=C/C=C(\C)CCC1CC(OC)=CC(=O)O1 |
| InChI | InChI=1S/C13H18O3/c1-4-5-10(2)6-7-11-8-12(15-3)9-13(14)16-11/h4-5,9,11H,1,6-8H2,2-3H3/b10-5+ |
| InChIKey | BYHMERWAAQJFKE-BJMVGYQFSA-N |
| XLogP | 2.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|