C32H44ClN5O4 — CID 142142352
N-tert-butyl-2-[3-[[2-[(6-chloropyridine-3-carbonyl)amino]acetyl]amino]-2-hydroxy-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide (PubChem CID 142142352) has the molecular formula C32H44ClN5O4 and a molecular weight of 598.19 g/mol. Its IUPAC name is N-tert-butyl-2-[3-[[2-[(6-chloropyridine-3-carbonyl)amino]acetyl]amino]-2-hydroxy-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide.
| Compound Name | N-tert-butyl-2-[3-[[2-[(6-chloropyridine-3-carbonyl)amino]acetyl]amino]-2-hydroxy-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 142142352 |
| Molecular Formula | C32H44ClN5O4 |
| Molecular Weight | 598.19 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | N-tert-butyl-2-[3-[[2-[(6-chloropyridine-3-carbonyl)amino]acetyl]amino]-2-hydroxy-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CC2CCCCC2CN1CC(O)C(Cc1ccccc1)NC(=O)CNC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C32H44ClN5O4/c1-32(2,3)37-31(42)26-16-22-11-7-8-12-24(22)19-38(26)20-27(39)25(15-21-9-5-4-6-10-21)36-29(40)18-35-30(41)23-13-14-28(33)34-17-23/h4-6,9-10,13-14,17,22,24-27,39H,7-8,11-12,15-16,18-20H2,1-3H3,(H,35,41)(H,36,40)(H,37,42) |
| InChIKey | AJFAHAROSHMDHL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.19 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|