C28H40N4O — CID 142143994
4-[[4-[(E)-5-methyl-6-[[(E)-2-methylbut-1-enyl]amino]hex-5-enyl]piperazin-1-yl]-pyridin-2-ylmethyl]phenol (PubChem CID 142143994) has the molecular formula C28H40N4O and a molecular weight of 448.66 g/mol. Its IUPAC name is 4-[[4-[(E)-5-methyl-6-[[(E)-2-methylbut-1-enyl]amino]hex-5-enyl]piperazin-1-yl]-pyridin-2-ylmethyl]phenol.
| Compound Name | 4-[[4-[(E)-5-methyl-6-[[(E)-2-methylbut-1-enyl]amino]hex-5-enyl]piperazin-1-yl]-pyridin-2-ylmethyl]phenol |
|---|---|
| PubChem CID | 142143994 |
| Molecular Formula | C28H40N4O |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | 4-[[4-[(E)-5-methyl-6-[[(E)-2-methylbut-1-enyl]amino]hex-5-enyl]piperazin-1-yl]-pyridin-2-ylmethyl]phenol |
| SMILES | CC/C(C)=C/N/C=C(\C)CCCCN1CCN(C(c2ccc(O)cc2)c2ccccn2)CC1 |
| InChI | InChI=1S/C28H40N4O/c1-4-23(2)21-29-22-24(3)9-6-8-16-31-17-19-32(20-18-31)28(27-10-5-7-15-30-27)25-11-13-26(33)14-12-25/h5,7,10-15,21-22,28-29,33H,4,6,8-9,16-20H2,1-3H3/b23-21+,24-22+ |
| InChIKey | KAKMOKBEDBBNPJ-MBALSZOMSA-N |
| XLogP | 5.47 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|