C28H34N6OS — CID 67805594
N-[3-[4-[phenyl(pyridin-2-yl)methyl]piperazin-1-yl]propyl]-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide (PubChem CID 67805594) has the molecular formula C28H34N6OS and a molecular weight of 502.69 g/mol. Its IUPAC name is N-[3-[4-[phenyl(pyridin-2-yl)methyl]piperazin-1-yl]propyl]-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[3-[4-[phenyl(pyridin-2-yl)methyl]piperazin-1-yl]propyl]-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 67805594 |
| Molecular Formula | C28H34N6OS |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | N-[3-[4-[phenyl(pyridin-2-yl)methyl]piperazin-1-yl]propyl]-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCN(C(c2ccccc2)c2ccccn2)CC1)C1CSC(c2cccnc2)N1 |
| InChI | InChI=1S/C28H34N6OS/c35-27(25-21-36-28(32-25)23-10-6-12-29-20-23)31-14-7-15-33-16-18-34(19-17-33)26(22-8-2-1-3-9-22)24-11-4-5-13-30-24/h1-6,8-13,20,25-26,28,32H,7,14-19,21H2,(H,31,35) |
| InChIKey | GMGFMATWGOIZQI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|