C31H37F2N5OS — CID 67805523
(4R)-N-[5-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]pentyl]-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide (PubChem CID 67805523) has the molecular formula C31H37F2N5OS and a molecular weight of 565.73 g/mol. Its IUPAC name is (4R)-N-[5-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]pentyl]-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-N-[5-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]pentyl]-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 67805523 |
| Molecular Formula | C31H37F2N5OS |
| Molecular Weight | 565.73 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | (4R)-N-[5-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]pentyl]-2-pyridin-3-yl-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(NCCCCCN1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1)[C@@H]1CSC(c2cccnc2)N1 |
| InChI | InChI=1S/C31H37F2N5OS/c32-26-10-6-23(7-11-26)29(24-8-12-27(33)13-9-24)38-19-17-37(18-20-38)16-3-1-2-15-35-30(39)28-22-40-31(36-28)25-5-4-14-34-21-25/h4-14,21,28-29,31,36H,1-3,15-20,22H2,(H,35,39)/t28-,31?/m0/s1 |
| InChIKey | GIHHALUNEWNJDK-NPHAVVRNSA-N |
| XLogP | 4.76 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.73 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|