C23H24O2 — CID 142144913
(2E,4E,6E)-7-ethoxy-1,7-bis(4-methylphenyl)hepta-2,4,6-trien-1-one (PubChem CID 142144913) has the molecular formula C23H24O2 and a molecular weight of 332.44 g/mol. Its IUPAC name is (2E,4E,6E)-7-ethoxy-1,7-bis(4-methylphenyl)hepta-2,4,6-trien-1-one.
| Compound Name | (2E,4E,6E)-7-ethoxy-1,7-bis(4-methylphenyl)hepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 142144913 |
| Molecular Formula | C23H24O2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (2E,4E,6E)-7-ethoxy-1,7-bis(4-methylphenyl)hepta-2,4,6-trien-1-one |
| SMILES | CCO/C(=C/C=C/C=C/C(=O)c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H24O2/c1-4-25-23(21-16-12-19(3)13-17-21)9-7-5-6-8-22(24)20-14-10-18(2)11-15-20/h5-17H,4H2,1-3H3/b7-5+,8-6+,23-9+ |
| InChIKey | OBSNYZGGIGHGCD-BAIOTMDTSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|