C27H34BF4NO3 — CID 131737664
[7-ethoxy-1,7-bis(4-methoxyphenyl)hepta-2,4,6-trienylidene]-diethylazanium tetrafluoroborate (PubChem CID 131737664) has the molecular formula C27H34BF4NO3 and a molecular weight of 507.38 g/mol. Its IUPAC name is [7-ethoxy-1,7-bis(4-methoxyphenyl)hepta-2,4,6-trienylidene]-diethylazanium tetrafluoroborate.
| Compound Name | [7-ethoxy-1,7-bis(4-methoxyphenyl)hepta-2,4,6-trienylidene]-diethylazanium tetrafluoroborate |
|---|---|
| PubChem CID | 131737664 |
| Molecular Formula | C27H34BF4NO3 |
| Molecular Weight | 507.38 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | [7-ethoxy-1,7-bis(4-methoxyphenyl)hepta-2,4,6-trienylidene]-diethylazanium tetrafluoroborate |
| SMILES | CCOC(=CC=CC=CC(c1ccc(OC)cc1)=[N+](CC)CC)c1ccc(OC)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C27H34NO3.BF4/c1-6-28(7-2)26(22-14-18-24(29-4)19-15-22)12-10-9-11-13-27(31-8-3)23-16-20-25(30-5)21-17-23;2-1(3,4)5/h9-21H,6-8H2,1-5H3;/q+1;-1 |
| InChIKey | CIVVGROMDPBFMV-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 30.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.38 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|