C25H33NO3 — CID 101029005
(2E,4E)-5-ethoxy-N,N-diethyl-1,5-bis(4-methoxyphenyl)penta-2,4-dien-1-amine (PubChem CID 101029005) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is (2E,4E)-5-ethoxy-N,N-diethyl-1,5-bis(4-methoxyphenyl)penta-2,4-dien-1-amine.
| Compound Name | (2E,4E)-5-ethoxy-N,N-diethyl-1,5-bis(4-methoxyphenyl)penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 101029005 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | (2E,4E)-5-ethoxy-N,N-diethyl-1,5-bis(4-methoxyphenyl)penta-2,4-dien-1-amine |
| SMILES | CCO/C(=C/C=C/C(c1ccc(OC)cc1)N(CC)CC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H33NO3/c1-6-26(7-2)24(20-12-16-22(27-4)17-13-20)10-9-11-25(29-8-3)21-14-18-23(28-5)19-15-21/h9-19,24H,6-8H2,1-5H3/b10-9+,25-11+ |
| InChIKey | GYNCLEZJMSTOBR-GSNDKAMVSA-N |
| XLogP | 5.72 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|