C15H15NaO5 — CID 23699163
sodium (2Z,4E)-1-ethoxy-6-(4-methoxyphenyl)-1,6-dioxohexa-2,4-dien-2-olate (PubChem CID 23699163) has the molecular formula C15H15NaO5 and a molecular weight of 298.27 g/mol. Its IUPAC name is sodium (2Z,4E)-1-ethoxy-6-(4-methoxyphenyl)-1,6-dioxohexa-2,4-dien-2-olate.
| Compound Name | sodium (2Z,4E)-1-ethoxy-6-(4-methoxyphenyl)-1,6-dioxohexa-2,4-dien-2-olate |
|---|---|
| PubChem CID | 23699163 |
| Molecular Formula | C15H15NaO5 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | sodium (2Z,4E)-1-ethoxy-6-(4-methoxyphenyl)-1,6-dioxohexa-2,4-dien-2-olate |
| SMILES | CCOC(=O)/C([O-])=C/C=C/C(=O)c1ccc(OC)cc1.[Na+] |
| InChI | InChI=1S/C15H16O5.Na/c1-3-20-15(18)14(17)6-4-5-13(16)11-7-9-12(19-2)10-8-11;/h4-10,17H,3H2,1-2H3;/q;+1/p-1/b5-4+,14-6-; |
| InChIKey | NVPTWESLPBCGAB-WDUKEEFASA-M |
| XLogP | -1.75 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|