C30H49N5O7 — CID 142146194
ethane;3-[[2-[[2-[2-methoxy-5-[N-methyl-C-(methylideneamino)oxycarbonimidoyl]phenyl]acetyl]amino]-3-methylbutanoyl]amino]-5-[methyl(pentyl)amino]-4-oxopentanoic acid (PubChem CID 142146194) has the molecular formula C30H49N5O7 and a molecular weight of 591.75 g/mol. Its IUPAC name is ethane;3-[[2-[[2-[2-methoxy-5-[N-methyl-C-(methylideneamino)oxycarbonimidoyl]phenyl]acetyl]amino]-3-methylbutanoyl]amino]-5-[methyl(pentyl)amino]-4-oxopentanoic acid.
| Compound Name | ethane;3-[[2-[[2-[2-methoxy-5-[N-methyl-C-(methylideneamino)oxycarbonimidoyl]phenyl]acetyl]amino]-3-methylbutanoyl]amino]-5-[methyl(pentyl)amino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 142146194 |
| Molecular Formula | C30H49N5O7 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.36 |
| IUPAC Name | ethane;3-[[2-[[2-[2-methoxy-5-[N-methyl-C-(methylideneamino)oxycarbonimidoyl]phenyl]acetyl]amino]-3-methylbutanoyl]amino]-5-[methyl(pentyl)amino]-4-oxopentanoic acid |
| SMILES | C=NO/C(=N\C)c1ccc(OC)c(CC(=O)NC(C(=O)NC(CC(=O)O)C(=O)CN(C)CCCCC)C(C)C)c1.CC |
| InChI | InChI=1S/C28H43N5O7.C2H6/c1-8-9-10-13-33(6)17-22(34)21(16-25(36)37)31-27(38)26(18(2)3)32-24(35)15-20-14-19(11-12-23(20)39-7)28(29-4)40-30-5;1-2/h11-12,14,18,21,26H,5,8-10,13,15-17H2,1-4,6-7H3,(H,31,38)(H,32,35)(H,36,37);1-2H3/b29-28-; |
| InChIKey | BUSMTQLAFSTJBN-FJBFXRHMSA-N |
| XLogP | 3.06 |
| TPSA | 158.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|