C25H35N5O7 — CID 142146263
5-(azetidin-1-yl)-3-[[2-[[2-[2-methoxy-5-[N-methyl-C-(methylideneamino)oxycarbonimidoyl]phenyl]acetyl]amino]-3-methylbutanoyl]amino]-4-oxopentanoic acid (PubChem CID 142146263) has the molecular formula C25H35N5O7 and a molecular weight of 517.58 g/mol. Its IUPAC name is 5-(azetidin-1-yl)-3-[[2-[[2-[2-methoxy-5-[N-methyl-C-(methylideneamino)oxycarbonimidoyl]phenyl]acetyl]amino]-3-methylbutanoyl]amino]-4-oxopentanoic acid.
| Compound Name | 5-(azetidin-1-yl)-3-[[2-[[2-[2-methoxy-5-[N-methyl-C-(methylideneamino)oxycarbonimidoyl]phenyl]acetyl]amino]-3-methylbutanoyl]amino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 142146263 |
| Molecular Formula | C25H35N5O7 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 5-(azetidin-1-yl)-3-[[2-[[2-[2-methoxy-5-[N-methyl-C-(methylideneamino)oxycarbonimidoyl]phenyl]acetyl]amino]-3-methylbutanoyl]amino]-4-oxopentanoic acid |
| SMILES | C=NO/C(=N\C)c1ccc(OC)c(CC(=O)NC(C(=O)NC(CC(=O)O)C(=O)CN2CCC2)C(C)C)c1 |
| InChI | InChI=1S/C25H35N5O7/c1-15(2)23(24(35)28-18(13-22(33)34)19(31)14-30-9-6-10-30)29-21(32)12-17-11-16(7-8-20(17)36-5)25(26-3)37-27-4/h7-8,11,15,18,23H,4,6,9-10,12-14H2,1-3,5H3,(H,28,35)(H,29,32)(H,33,34)/b26-25- |
| InChIKey | CCTRFTGDEKDLHN-QPLCGJKRSA-N |
| XLogP | 0.62 |
| TPSA | 158.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|