C15H27NO4 — CID 142146353
(9-ethenyl-7-ethyl-8-hydroxy-6,7,9-trimethyl-1,4-dioxa-8-azaspiro[4.5]decan-3-yl)methanol (PubChem CID 142146353) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is (9-ethenyl-7-ethyl-8-hydroxy-6,7,9-trimethyl-1,4-dioxa-8-azaspiro[4.5]decan-3-yl)methanol.
| Compound Name | (9-ethenyl-7-ethyl-8-hydroxy-6,7,9-trimethyl-1,4-dioxa-8-azaspiro[4.5]decan-3-yl)methanol |
|---|---|
| PubChem CID | 142146353 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (9-ethenyl-7-ethyl-8-hydroxy-6,7,9-trimethyl-1,4-dioxa-8-azaspiro[4.5]decan-3-yl)methanol |
| SMILES | C=CC1(C)CC2(OCC(CO)O2)C(C)C(C)(CC)N1O |
| InChI | InChI=1S/C15H27NO4/c1-6-13(4)10-15(19-9-12(8-17)20-15)11(3)14(5,7-2)16(13)18/h6,11-12,17-18H,1,7-10H2,2-5H3 |
| InChIKey | PEHXSUREQLWUDD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|