About 1,2-diethyl-5-[(4-methylpiperazin-1-yl)methyl]benzimidazole;1-(3-fluorophenyl)pyrazole
1,2-diethyl-5-[(4-methylpiperazin-1-yl)methyl]benzimidazole;1-(3-fluorophenyl)pyrazole (PubChem CID 142149514) has the molecular formula C26H33FN6
and a molecular weight of 448.59 g/mol. Its IUPAC name is 1,2-diethyl-5-[(4-methylpiperazin-1-yl)methyl]benzimidazole;1-(3-fluorophenyl)pyrazole.
Molecular Properties
| Compound Name | 1,2-diethyl-5-[(4-methylpiperazin-1-yl)methyl]benzimidazole;1-(3-fluorophenyl)pyrazole |
| PubChem CID | 142149514 |
| Molecular Formula | C26H33FN6 |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 1,2-diethyl-5-[(4-methylpiperazin-1-yl)methyl]benzimidazole;1-(3-fluorophenyl)pyrazole |
| SMILES | CCc1nc2cc(CN3CCN(C)CC3)ccc2n1CC.Fc1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C17H26N4.C9H7FN2/c1-4-17-18-15-12-14(6-7-16(15)21(17)5-2)13-20-10-8-19(3)9-11-20;10-8-3-1-4-9(7-8)12-6-2-5-11-12/h6-7,12H,4-5,8-11,13H2,1-3H3;1-7H |
| InChIKey | JLLMZPIXUHXMEG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,2-diethyl-5-[(4-methylpiperazin-1-yl)methyl]benzimidazole;1-(3-fluorophenyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethyl-5-[(4-methylpiperazin-1-yl)methyl]benzimidazole;1-(3-fluorophenyl)pyrazole?
The IUPAC name of 1,2-diethyl-5-[(4-methylpiperazin-1-yl)methyl]benzimidazole;1-(3-fluorophenyl)pyrazole (CID 142149514) is 1,2-diethyl-5-[(4-methylpiperazin-1-yl)methyl]benzimidazole;1-(3-fluorophenyl)pyrazole.
What is the SMILES notation for 1,2-diethyl-5-[(4-methylpiperazin-1-yl)methyl]benzimidazole;1-(3-fluorophenyl)pyrazole?
The canonical SMILES for 1,2-diethyl-5-[(4-methylpiperazin-1-yl)methyl]benzimidazole;1-(3-fluorophenyl)pyrazole is CCc1nc2cc(CN3CCN(C)CC3)ccc2n1CC.Fc1cccc(-n2cccn2)c1.
What is the InChIKey of 1,2-diethyl-5-[(4-methylpiperazin-1-yl)methyl]benzimidazole;1-(3-fluorophenyl)pyrazole?
The InChIKey is JLLMZPIXUHXMEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4.C9H7FN2/c1-4-17-18-15-12-14(6-7-16(15)21(17)5-2)13-20-10-8-19(3)9-11-20;10-8-3-1-4-9(7-8)12-6-2-5-11-12/h6-7,12H,4-5,8-11,13H2,1-3H3;1-7H.
What are the key properties of 1,2-diethyl-5-[(4-methylpiperazin-1-yl)methyl]benzimidazole;1-(3-fluorophenyl)pyrazole?
1,2-diethyl-5-[(4-methylpiperazin-1-yl)methyl]benzimidazole;1-(3-fluorophenyl)pyrazole has a molecular weight of 448.59 g/mol, XLogP of 4.38, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethyl-5-[(4-methylpiperazin-1-yl)methyl]benzimidazole;1-(3-fluorophenyl)pyrazole is sourced from PubChem (CID 142149514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).