C19H18FN5O — CID 142149625
3-ethyl-2-[[2-(6-fluoro-2-pyridinyl)-1,2-dihydroimidazol-3-yl]methyl]benzimidazole-5-carbaldehyde (PubChem CID 142149625) has the molecular formula C19H18FN5O and a molecular weight of 351.39 g/mol. Its IUPAC name is 3-ethyl-2-[[2-(6-fluoro-2-pyridinyl)-1,2-dihydroimidazol-3-yl]methyl]benzimidazole-5-carbaldehyde.
| Compound Name | 3-ethyl-2-[[2-(6-fluoro-2-pyridinyl)-1,2-dihydroimidazol-3-yl]methyl]benzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 142149625 |
| Molecular Formula | C19H18FN5O |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 3-ethyl-2-[[2-(6-fluoro-2-pyridinyl)-1,2-dihydroimidazol-3-yl]methyl]benzimidazole-5-carbaldehyde |
| SMILES | CCn1c(CN2C=CNC2c2cccc(F)n2)nc2ccc(C=O)cc21 |
| InChI | InChI=1S/C19H18FN5O/c1-2-25-16-10-13(12-26)6-7-14(16)23-18(25)11-24-9-8-21-19(24)15-4-3-5-17(20)22-15/h3-10,12,19,21H,2,11H2,1H3 |
| InChIKey | XPNBKKBYSXLEIB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|