C20H25ClN4OS — CID 143667857
2-[[(4-chlorophenyl)sulfanylamino]methyl]-3-ethylbenzimidazole-5-carbaldehyde;N,N-dimethylmethanamine (PubChem CID 143667857) has the molecular formula C20H25ClN4OS and a molecular weight of 404.97 g/mol. Its IUPAC name is 2-[[(4-chlorophenyl)sulfanylamino]methyl]-3-ethylbenzimidazole-5-carbaldehyde;N,N-dimethylmethanamine.
| Compound Name | 2-[[(4-chlorophenyl)sulfanylamino]methyl]-3-ethylbenzimidazole-5-carbaldehyde;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 143667857 |
| Molecular Formula | C20H25ClN4OS |
| Molecular Weight | 404.97 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-[[(4-chlorophenyl)sulfanylamino]methyl]-3-ethylbenzimidazole-5-carbaldehyde;N,N-dimethylmethanamine |
| SMILES | CCn1c(CNSc2ccc(Cl)cc2)nc2ccc(C=O)cc21.CN(C)C |
| InChI | InChI=1S/C17H16ClN3OS.C3H9N/c1-2-21-16-9-12(11-22)3-8-15(16)20-17(21)10-19-23-14-6-4-13(18)5-7-14;1-4(2)3/h3-9,11,19H,2,10H2,1H3;1-3H3 |
| InChIKey | ZOGFDTYUCLAJNR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.97 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|