C16H14ClF3N4S — CID 143667934
N-(4-chlorophenyl)sulfanyl-1-[1-ethyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]methanamine (PubChem CID 143667934) has the molecular formula C16H14ClF3N4S and a molecular weight of 386.83 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfanyl-1-[1-ethyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]methanamine.
| Compound Name | N-(4-chlorophenyl)sulfanyl-1-[1-ethyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]methanamine |
|---|---|
| PubChem CID | 143667934 |
| Molecular Formula | C16H14ClF3N4S |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-(4-chlorophenyl)sulfanyl-1-[1-ethyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]methanamine |
| SMILES | CCn1c(CNSc2ccc(Cl)cc2)nc2cnc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C16H14ClF3N4S/c1-2-24-13-7-14(16(18,19)20)21-8-12(13)23-15(24)9-22-25-11-5-3-10(17)4-6-11/h3-8,22H,2,9H2,1H3 |
| InChIKey | VKJLOSXJHPQTHJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|