C17H16ClF2N3S — CID 143667913
N-(4-chlorophenyl)sulfanyl-1-[6-(difluoromethyl)-1-ethylbenzimidazol-2-yl]methanamine (PubChem CID 143667913) has the molecular formula C17H16ClF2N3S and a molecular weight of 367.85 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfanyl-1-[6-(difluoromethyl)-1-ethylbenzimidazol-2-yl]methanamine.
| Compound Name | N-(4-chlorophenyl)sulfanyl-1-[6-(difluoromethyl)-1-ethylbenzimidazol-2-yl]methanamine |
|---|---|
| PubChem CID | 143667913 |
| Molecular Formula | C17H16ClF2N3S |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N-(4-chlorophenyl)sulfanyl-1-[6-(difluoromethyl)-1-ethylbenzimidazol-2-yl]methanamine |
| SMILES | CCn1c(CNSc2ccc(Cl)cc2)nc2ccc(C(F)F)cc21 |
| InChI | InChI=1S/C17H16ClF2N3S/c1-2-23-15-9-11(17(19)20)3-8-14(15)22-16(23)10-21-24-13-6-4-12(18)5-7-13/h3-9,17,21H,2,10H2,1H3 |
| InChIKey | NGTDYJIGHRQJCV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|